About CID 156725408
CID 156725408 (PubChem CID 156725408) has the molecular formula C9H7BO
and a molecular weight of 141.97 g/mol.
Molecular Properties
| Compound Name | CID 156725408 |
| PubChem CID | 156725408 |
| Molecular Formula | C9H7BO |
| Molecular Weight | 141.97 g/mol |
| Exact Mass | 142.06 |
| IUPAC Name | — |
| SMILES | [B]Cc1cc2ccccc2o1 |
| InChI | InChI=1S/C9H7BO/c10-6-8-5-7-3-1-2-4-9(7)11-8/h1-5H,6H2 |
| InChIKey | MVZZAOQBUJDUEB-UHFFFAOYSA-N |
| XLogP | 2.10 |
| TPSA | 13.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 141.97 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze CID 156725408 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 156725408?
The IUPAC name of CID 156725408 (CID 156725408) is not available.
What is the SMILES notation for CID 156725408?
The canonical SMILES for CID 156725408 is [B]Cc1cc2ccccc2o1.
What is the InChIKey of CID 156725408?
The InChIKey is MVZZAOQBUJDUEB-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H7BO/c10-6-8-5-7-3-1-2-4-9(7)11-8/h1-5H,6H2.
What are the key properties of CID 156725408?
CID 156725408 has a molecular weight of 141.97 g/mol, XLogP of 2.10, 1 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for CID 156725408 is sourced from PubChem (CID 156725408), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).