C12H14O3 — CID 102166190
4-(1-benzofuran-2-yl)butane-1,2-diol (PubChem CID 102166190) has the molecular formula C12H14O3 and a molecular weight of 206.24 g/mol. Its IUPAC name is 4-(1-benzofuran-2-yl)butane-1,2-diol.
| Compound Name | 4-(1-benzofuran-2-yl)butane-1,2-diol |
|---|---|
| PubChem CID | 102166190 |
| Molecular Formula | C12H14O3 |
| Molecular Weight | 206.24 g/mol |
| Exact Mass | 206.09 |
| IUPAC Name | 4-(1-benzofuran-2-yl)butane-1,2-diol |
| SMILES | OCC(O)CCc1cc2ccccc2o1 |
| InChI | InChI=1S/C12H14O3/c13-8-10(14)5-6-11-7-9-3-1-2-4-12(9)15-11/h1-4,7,10,13-14H,5-6,8H2 |
| InChIKey | XGSRVVVHMGSPGV-UHFFFAOYSA-N |
| XLogP | 1.72 |
| TPSA | 53.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 206.24 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |