C15H21NO — CID 114733291
1-(1-benzofuran-2-yl)-4,4-dimethylpentan-3-amine (PubChem CID 114733291) has the molecular formula C15H21NO and a molecular weight of 231.34 g/mol. Its IUPAC name is 1-(1-benzofuran-2-yl)-4,4-dimethylpentan-3-amine.
| Compound Name | 1-(1-benzofuran-2-yl)-4,4-dimethylpentan-3-amine |
|---|---|
| PubChem CID | 114733291 |
| Molecular Formula | C15H21NO |
| Molecular Weight | 231.34 g/mol |
| Exact Mass | 231.16 |
| IUPAC Name | 1-(1-benzofuran-2-yl)-4,4-dimethylpentan-3-amine |
| SMILES | CC(C)(C)C(N)CCc1cc2ccccc2o1 |
| InChI | InChI=1S/C15H21NO/c1-15(2,3)14(16)9-8-12-10-11-6-4-5-7-13(11)17-12/h4-7,10,14H,8-9,16H2,1-3H3 |
| InChIKey | CVRDXGYGNYPLDO-UHFFFAOYSA-N |
| XLogP | 3.74 |
| TPSA | 39.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 231.34 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |