C19H13F3N2O3 — CID 34155699
1-benzofuran-2-ylmethyl 2-[2-(trifluoromethyl)benzimidazol-1-yl]acetate (PubChem CID 34155699) has the molecular formula C19H13F3N2O3 and a molecular weight of 374.32 g/mol. Its IUPAC name is 1-benzofuran-2-ylmethyl 2-[2-(trifluoromethyl)benzimidazol-1-yl]acetate.
| Compound Name | 1-benzofuran-2-ylmethyl 2-[2-(trifluoromethyl)benzimidazol-1-yl]acetate |
|---|---|
| PubChem CID | 34155699 |
| Molecular Formula | C19H13F3N2O3 |
| Molecular Weight | 374.32 g/mol |
| Exact Mass | 374.09 |
| IUPAC Name | 1-benzofuran-2-ylmethyl 2-[2-(trifluoromethyl)benzimidazol-1-yl]acetate |
| SMILES | O=C(Cn1c(C(F)(F)F)nc2ccccc21)OCc1cc2ccccc2o1 |
| InChI | InChI=1S/C19H13F3N2O3/c20-19(21,22)18-23-14-6-2-3-7-15(14)24(18)10-17(25)26-11-13-9-12-5-1-4-8-16(12)27-13/h1-9H,10-11H2 |
| InChIKey | JVRJPLRLNLWXPR-UHFFFAOYSA-N |
| XLogP | 4.54 |
| TPSA | 57.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.32 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |