C22H23F3N2O3 — CID 5114931
[2-(1-adamantyl)-2-oxoethyl] 2-[2-(trifluoromethyl)benzimidazol-1-yl]acetate (PubChem CID 5114931) has the molecular formula C22H23F3N2O3 and a molecular weight of 420.43 g/mol. Its IUPAC name is [2-(1-adamantyl)-2-oxoethyl] 2-[2-(trifluoromethyl)benzimidazol-1-yl]acetate.
| Compound Name | [2-(1-adamantyl)-2-oxoethyl] 2-[2-(trifluoromethyl)benzimidazol-1-yl]acetate |
|---|---|
| PubChem CID | 5114931 |
| Molecular Formula | C22H23F3N2O3 |
| Molecular Weight | 420.43 g/mol |
| Exact Mass | 420.17 |
| IUPAC Name | [2-(1-adamantyl)-2-oxoethyl] 2-[2-(trifluoromethyl)benzimidazol-1-yl]acetate |
| SMILES | O=C(Cn1c(C(F)(F)F)nc2ccccc21)OCC(=O)C12CC3CC(CC(C3)C1)C2 |
| InChI | InChI=1S/C22H23F3N2O3/c23-22(24,25)20-26-16-3-1-2-4-17(16)27(20)11-19(29)30-12-18(28)21-8-13-5-14(9-21)7-15(6-13)10-21/h1-4,13-15H,5-12H2 |
| InChIKey | QMBRJDLUPCDEIY-UHFFFAOYSA-N |
| XLogP | 4.38 |
| TPSA | 61.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.43 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |