About (1-fluorosulfanyl-1,2,4-triazol-3-yl)methyl imidazole-1-carboxylate
(1-fluorosulfanyl-1,2,4-triazol-3-yl)methyl imidazole-1-carboxylate (PubChem CID 142433509) has the molecular formula C7H6FN5O2S
and a molecular weight of 243.22 g/mol. Its IUPAC name is (1-fluorosulfanyl-1,2,4-triazol-3-yl)methyl imidazole-1-carboxylate.
Molecular Properties
| Compound Name | (1-fluorosulfanyl-1,2,4-triazol-3-yl)methyl imidazole-1-carboxylate |
| PubChem CID | 142433509 |
| Molecular Formula | C7H6FN5O2S |
| Molecular Weight | 243.22 g/mol |
| Exact Mass | 243.02 |
| IUPAC Name | (1-fluorosulfanyl-1,2,4-triazol-3-yl)methyl imidazole-1-carboxylate |
| SMILES | O=C(OCc1ncn(SF)n1)n1ccnc1 |
| InChI | InChI=1S/C7H6FN5O2S/c8-16-13-5-10-6(11-13)3-15-7(14)12-2-1-9-4-12/h1-2,4-5H,3H2 |
| InChIKey | XCIRCIFZBGBHRM-UHFFFAOYSA-N |
| XLogP | 1.04 |
| TPSA | 74.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 243.22 |
| LogP ≤ 5 | 1.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
Analyze (1-fluorosulfanyl-1,2,4-triazol-3-yl)methyl imidazole-1-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (1-fluorosulfanyl-1,2,4-triazol-3-yl)methyl imidazole-1-carboxylate?
The IUPAC name of (1-fluorosulfanyl-1,2,4-triazol-3-yl)methyl imidazole-1-carboxylate (CID 142433509) is (1-fluorosulfanyl-1,2,4-triazol-3-yl)methyl imidazole-1-carboxylate.
What is the SMILES notation for (1-fluorosulfanyl-1,2,4-triazol-3-yl)methyl imidazole-1-carboxylate?
The canonical SMILES for (1-fluorosulfanyl-1,2,4-triazol-3-yl)methyl imidazole-1-carboxylate is O=C(OCc1ncn(SF)n1)n1ccnc1.
What is the InChIKey of (1-fluorosulfanyl-1,2,4-triazol-3-yl)methyl imidazole-1-carboxylate?
The InChIKey is XCIRCIFZBGBHRM-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H6FN5O2S/c8-16-13-5-10-6(11-13)3-15-7(14)12-2-1-9-4-12/h1-2,4-5H,3H2.
What are the key properties of (1-fluorosulfanyl-1,2,4-triazol-3-yl)methyl imidazole-1-carboxylate?
(1-fluorosulfanyl-1,2,4-triazol-3-yl)methyl imidazole-1-carboxylate has a molecular weight of 243.22 g/mol, XLogP of 1.04, 3 rotatable bonds, 0 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for (1-fluorosulfanyl-1,2,4-triazol-3-yl)methyl imidazole-1-carboxylate is sourced from PubChem (CID 142433509), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).