About [2-(imidazole-1-carbonyloxy)-3-(pyrrole-1-carbonyloxy)propyl] imidazole-1-carboxylate
[2-(imidazole-1-carbonyloxy)-3-(pyrrole-1-carbonyloxy)propyl] imidazole-1-carboxylate (PubChem CID 166007787) has the molecular formula C16H15N5O6
and a molecular weight of 373.33 g/mol. Its IUPAC name is [2-(imidazole-1-carbonyloxy)-3-(pyrrole-1-carbonyloxy)propyl] imidazole-1-carboxylate.
Molecular Properties
| Compound Name | [2-(imidazole-1-carbonyloxy)-3-(pyrrole-1-carbonyloxy)propyl] imidazole-1-carboxylate |
| PubChem CID | 166007787 |
| Molecular Formula | C16H15N5O6 |
| Molecular Weight | 373.33 g/mol |
| Exact Mass | 373.10 |
| IUPAC Name | [2-(imidazole-1-carbonyloxy)-3-(pyrrole-1-carbonyloxy)propyl] imidazole-1-carboxylate |
| SMILES | O=C(OCC(COC(=O)n1ccnc1)OC(=O)n1ccnc1)n1cccc1 |
| InChI | InChI=1S/C16H15N5O6/c22-14(19-5-1-2-6-19)25-9-13(27-16(24)21-8-4-18-12-21)10-26-15(23)20-7-3-17-11-20/h1-8,11-13H,9-10H2 |
| InChIKey | MLKFVAHARNVZJM-UHFFFAOYSA-N |
| XLogP | 1.60 |
| TPSA | 119.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 373.33 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 11 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|
Analyze [2-(imidazole-1-carbonyloxy)-3-(pyrrole-1-carbonyloxy)propyl] imidazole-1-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [2-(imidazole-1-carbonyloxy)-3-(pyrrole-1-carbonyloxy)propyl] imidazole-1-carboxylate?
The IUPAC name of [2-(imidazole-1-carbonyloxy)-3-(pyrrole-1-carbonyloxy)propyl] imidazole-1-carboxylate (CID 166007787) is [2-(imidazole-1-carbonyloxy)-3-(pyrrole-1-carbonyloxy)propyl] imidazole-1-carboxylate.
What is the SMILES notation for [2-(imidazole-1-carbonyloxy)-3-(pyrrole-1-carbonyloxy)propyl] imidazole-1-carboxylate?
The canonical SMILES for [2-(imidazole-1-carbonyloxy)-3-(pyrrole-1-carbonyloxy)propyl] imidazole-1-carboxylate is O=C(OCC(COC(=O)n1ccnc1)OC(=O)n1ccnc1)n1cccc1.
What is the InChIKey of [2-(imidazole-1-carbonyloxy)-3-(pyrrole-1-carbonyloxy)propyl] imidazole-1-carboxylate?
The InChIKey is MLKFVAHARNVZJM-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H15N5O6/c22-14(19-5-1-2-6-19)25-9-13(27-16(24)21-8-4-18-12-21)10-26-15(23)20-7-3-17-11-20/h1-8,11-13H,9-10H2.
What are the key properties of [2-(imidazole-1-carbonyloxy)-3-(pyrrole-1-carbonyloxy)propyl] imidazole-1-carboxylate?
[2-(imidazole-1-carbonyloxy)-3-(pyrrole-1-carbonyloxy)propyl] imidazole-1-carboxylate has a molecular weight of 373.33 g/mol, XLogP of 1.60, 5 rotatable bonds, 0 hydrogen bond donors, and 11 hydrogen bond acceptors.
Where does this data come from?
All data for [2-(imidazole-1-carbonyloxy)-3-(pyrrole-1-carbonyloxy)propyl] imidazole-1-carboxylate is sourced from PubChem (CID 166007787), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).