About (4-methoxy-4-oxobutyl) 2-amino-5-methylbenzoate
(4-methoxy-4-oxobutyl) 2-amino-5-methylbenzoate (PubChem CID 65455835) has the molecular formula C13H17NO4
and a molecular weight of 251.28 g/mol. Its IUPAC name is (4-methoxy-4-oxobutyl) 2-amino-5-methylbenzoate.
Molecular Properties
| Compound Name | (4-methoxy-4-oxobutyl) 2-amino-5-methylbenzoate |
| PubChem CID | 65455835 |
| Molecular Formula | C13H17NO4 |
| Molecular Weight | 251.28 g/mol |
| Exact Mass | 251.12 |
| IUPAC Name | (4-methoxy-4-oxobutyl) 2-amino-5-methylbenzoate |
| SMILES | COC(=O)CCCOC(=O)c1cc(C)ccc1N |
| InChI | InChI=1S/C13H17NO4/c1-9-5-6-11(14)10(8-9)13(16)18-7-3-4-12(15)17-2/h5-6,8H,3-4,7,14H2,1-2H3 |
| InChIKey | KPFQYXDGRRBTSV-UHFFFAOYSA-N |
| XLogP | 1.69 |
| TPSA | 78.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 251.28 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze (4-methoxy-4-oxobutyl) 2-amino-5-methylbenzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4-methoxy-4-oxobutyl) 2-amino-5-methylbenzoate?
The IUPAC name of (4-methoxy-4-oxobutyl) 2-amino-5-methylbenzoate (CID 65455835) is (4-methoxy-4-oxobutyl) 2-amino-5-methylbenzoate.
What is the SMILES notation for (4-methoxy-4-oxobutyl) 2-amino-5-methylbenzoate?
The canonical SMILES for (4-methoxy-4-oxobutyl) 2-amino-5-methylbenzoate is COC(=O)CCCOC(=O)c1cc(C)ccc1N.
What is the InChIKey of (4-methoxy-4-oxobutyl) 2-amino-5-methylbenzoate?
The InChIKey is KPFQYXDGRRBTSV-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H17NO4/c1-9-5-6-11(14)10(8-9)13(16)18-7-3-4-12(15)17-2/h5-6,8H,3-4,7,14H2,1-2H3.
What are the key properties of (4-methoxy-4-oxobutyl) 2-amino-5-methylbenzoate?
(4-methoxy-4-oxobutyl) 2-amino-5-methylbenzoate has a molecular weight of 251.28 g/mol, XLogP of 1.69, 5 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for (4-methoxy-4-oxobutyl) 2-amino-5-methylbenzoate is sourced from PubChem (CID 65455835), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).