About iodo 2-amino-5-methylbenzoate
iodo 2-amino-5-methylbenzoate (PubChem CID 174945201) has the molecular formula C8H8INO2
and a molecular weight of 277.06 g/mol. Its IUPAC name is iodo 2-amino-5-methylbenzoate.
Molecular Properties
| Compound Name | iodo 2-amino-5-methylbenzoate |
| PubChem CID | 174945201 |
| Molecular Formula | C8H8INO2 |
| Molecular Weight | 277.06 g/mol |
| Exact Mass | 276.96 |
| IUPAC Name | iodo 2-amino-5-methylbenzoate |
| SMILES | Cc1ccc(N)c(C(=O)OI)c1 |
| InChI | InChI=1S/C8H8INO2/c1-5-2-3-7(10)6(4-5)8(11)12-9/h2-4H,10H2,1H3 |
| InChIKey | HOGADNJANJVTOL-UHFFFAOYSA-N |
| XLogP | 2.08 |
| TPSA | 52.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 277.06 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze iodo 2-amino-5-methylbenzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of iodo 2-amino-5-methylbenzoate?
The IUPAC name of iodo 2-amino-5-methylbenzoate (CID 174945201) is iodo 2-amino-5-methylbenzoate.
What is the SMILES notation for iodo 2-amino-5-methylbenzoate?
The canonical SMILES for iodo 2-amino-5-methylbenzoate is Cc1ccc(N)c(C(=O)OI)c1.
What is the InChIKey of iodo 2-amino-5-methylbenzoate?
The InChIKey is HOGADNJANJVTOL-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H8INO2/c1-5-2-3-7(10)6(4-5)8(11)12-9/h2-4H,10H2,1H3.
What are the key properties of iodo 2-amino-5-methylbenzoate?
iodo 2-amino-5-methylbenzoate has a molecular weight of 277.06 g/mol, XLogP of 2.08, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for iodo 2-amino-5-methylbenzoate is sourced from PubChem (CID 174945201), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).