About [1-(dimethylamino)-1-oxopropan-2-yl] 2-amino-5-methylbenzoate
[1-(dimethylamino)-1-oxopropan-2-yl] 2-amino-5-methylbenzoate (PubChem CID 60768575) has the molecular formula C13H18N2O3
and a molecular weight of 250.30 g/mol. Its IUPAC name is [1-(dimethylamino)-1-oxopropan-2-yl] 2-amino-5-methylbenzoate.
Molecular Properties
| Compound Name | [1-(dimethylamino)-1-oxopropan-2-yl] 2-amino-5-methylbenzoate |
| PubChem CID | 60768575 |
| Molecular Formula | C13H18N2O3 |
| Molecular Weight | 250.30 g/mol |
| Exact Mass | 250.13 |
| IUPAC Name | [1-(dimethylamino)-1-oxopropan-2-yl] 2-amino-5-methylbenzoate |
| SMILES | Cc1ccc(N)c(C(=O)OC(C)C(=O)N(C)C)c1 |
| InChI | InChI=1S/C13H18N2O3/c1-8-5-6-11(14)10(7-8)13(17)18-9(2)12(16)15(3)4/h5-7,9H,14H2,1-4H3 |
| InChIKey | ITMYPSZAGJKSHZ-UHFFFAOYSA-N |
| XLogP | 1.21 |
| TPSA | 72.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 250.30 |
| LogP ≤ 5 | 1.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze [1-(dimethylamino)-1-oxopropan-2-yl] 2-amino-5-methylbenzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [1-(dimethylamino)-1-oxopropan-2-yl] 2-amino-5-methylbenzoate?
The IUPAC name of [1-(dimethylamino)-1-oxopropan-2-yl] 2-amino-5-methylbenzoate (CID 60768575) is [1-(dimethylamino)-1-oxopropan-2-yl] 2-amino-5-methylbenzoate.
What is the SMILES notation for [1-(dimethylamino)-1-oxopropan-2-yl] 2-amino-5-methylbenzoate?
The canonical SMILES for [1-(dimethylamino)-1-oxopropan-2-yl] 2-amino-5-methylbenzoate is Cc1ccc(N)c(C(=O)OC(C)C(=O)N(C)C)c1.
What is the InChIKey of [1-(dimethylamino)-1-oxopropan-2-yl] 2-amino-5-methylbenzoate?
The InChIKey is ITMYPSZAGJKSHZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H18N2O3/c1-8-5-6-11(14)10(7-8)13(17)18-9(2)12(16)15(3)4/h5-7,9H,14H2,1-4H3.
What are the key properties of [1-(dimethylamino)-1-oxopropan-2-yl] 2-amino-5-methylbenzoate?
[1-(dimethylamino)-1-oxopropan-2-yl] 2-amino-5-methylbenzoate has a molecular weight of 250.30 g/mol, XLogP of 1.21, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [1-(dimethylamino)-1-oxopropan-2-yl] 2-amino-5-methylbenzoate is sourced from PubChem (CID 60768575), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).