C18H20F4N2O6 — CID 157070624
methane;methyl 2-amino-4,5-difluorobenzoate;methyl 4,5-difluoro-2-nitrobenzoate (PubChem CID 157070624) has the molecular formula C18H20F4N2O6 and a molecular weight of 436.36 g/mol. Its IUPAC name is methane;methyl 2-amino-4,5-difluorobenzoate;methyl 4,5-difluoro-2-nitrobenzoate.
| Compound Name | methane;methyl 2-amino-4,5-difluorobenzoate;methyl 4,5-difluoro-2-nitrobenzoate |
|---|---|
| PubChem CID | 157070624 |
| Molecular Formula | C18H20F4N2O6 |
| Molecular Weight | 436.36 g/mol |
| Exact Mass | 436.13 |
| IUPAC Name | methane;methyl 2-amino-4,5-difluorobenzoate;methyl 4,5-difluoro-2-nitrobenzoate |
| SMILES | C.C.COC(=O)c1cc(F)c(F)cc1N.COC(=O)c1cc(F)c(F)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C8H5F2NO4.C8H7F2NO2.2CH4/c1-15-8(12)4-2-5(9)6(10)3-7(4)11(13)14;1-13-8(12)4-2-5(9)6(10)3-7(4)11;;/h2-3H,1H3;2-3H,11H2,1H3;2*1H4 |
| InChIKey | ACJRNEHYDYODMC-UHFFFAOYSA-N |
| XLogP | 4.27 |
| TPSA | 121.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.36 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|