C18H18F2N2O7 — CID 159450517
methyl 4-amino-2,5-difluorobenzoate;methyl 5-methoxy-2-methyl-4-nitrobenzoate (PubChem CID 159450517) has the molecular formula C18H18F2N2O7 and a molecular weight of 412.35 g/mol. Its IUPAC name is methyl 4-amino-2,5-difluorobenzoate;methyl 5-methoxy-2-methyl-4-nitrobenzoate.
| Compound Name | methyl 4-amino-2,5-difluorobenzoate;methyl 5-methoxy-2-methyl-4-nitrobenzoate |
|---|---|
| PubChem CID | 159450517 |
| Molecular Formula | C18H18F2N2O7 |
| Molecular Weight | 412.35 g/mol |
| Exact Mass | 412.11 |
| IUPAC Name | methyl 4-amino-2,5-difluorobenzoate;methyl 5-methoxy-2-methyl-4-nitrobenzoate |
| SMILES | COC(=O)c1cc(F)c(N)cc1F.COC(=O)c1cc(OC)c([N+](=O)[O-])cc1C |
| InChI | InChI=1S/C10H11NO5.C8H7F2NO2/c1-6-4-8(11(13)14)9(15-2)5-7(6)10(12)16-3;1-13-8(12)4-2-6(10)7(11)3-5(4)9/h4-5H,1-3H3;2-3H,11H2,1H3 |
| InChIKey | LTHUTOIWKQITGR-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 130.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.35 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|