C14H16N2O4S — CID 115690511
(4-methyl-1,3-thiazol-2-yl)methyl 2-amino-3,5-dimethoxybenzoate (PubChem CID 115690511) has the molecular formula C14H16N2O4S and a molecular weight of 308.36 g/mol. Its IUPAC name is (4-methyl-1,3-thiazol-2-yl)methyl 2-amino-3,5-dimethoxybenzoate.
| Compound Name | (4-methyl-1,3-thiazol-2-yl)methyl 2-amino-3,5-dimethoxybenzoate |
|---|---|
| PubChem CID | 115690511 |
| Molecular Formula | C14H16N2O4S |
| Molecular Weight | 308.36 g/mol |
| Exact Mass | 308.08 |
| IUPAC Name | (4-methyl-1,3-thiazol-2-yl)methyl 2-amino-3,5-dimethoxybenzoate |
| SMILES | COc1cc(OC)c(N)c(C(=O)OCc2nc(C)cs2)c1 |
| InChI | InChI=1S/C14H16N2O4S/c1-8-7-21-12(16-8)6-20-14(17)10-4-9(18-2)5-11(19-3)13(10)15/h4-5,7H,6,15H2,1-3H3 |
| InChIKey | NRFWFGJHMXJXKN-UHFFFAOYSA-N |
| XLogP | 2.41 |
| TPSA | 83.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.36 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|