C12H10Cl2N2O2S — CID 166404542
(4-methyl-1,3-thiazol-2-yl)methyl 5,6-dichloro-2-methylpyridine-3-carboxylate (PubChem CID 166404542) has the molecular formula C12H10Cl2N2O2S and a molecular weight of 317.20 g/mol. Its IUPAC name is (4-methyl-1,3-thiazol-2-yl)methyl 5,6-dichloro-2-methylpyridine-3-carboxylate.
| Compound Name | (4-methyl-1,3-thiazol-2-yl)methyl 5,6-dichloro-2-methylpyridine-3-carboxylate |
|---|---|
| PubChem CID | 166404542 |
| Molecular Formula | C12H10Cl2N2O2S |
| Molecular Weight | 317.20 g/mol |
| Exact Mass | 315.98 |
| IUPAC Name | (4-methyl-1,3-thiazol-2-yl)methyl 5,6-dichloro-2-methylpyridine-3-carboxylate |
| SMILES | Cc1csc(COC(=O)c2cc(Cl)c(Cl)nc2C)n1 |
| InChI | InChI=1S/C12H10Cl2N2O2S/c1-6-5-19-10(15-6)4-18-12(17)8-3-9(13)11(14)16-7(8)2/h3,5H,4H2,1-2H3 |
| InChIKey | PWUOBBGCDUQIKL-UHFFFAOYSA-N |
| XLogP | 3.82 |
| TPSA | 52.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.20 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|