C14H12N4O2S — CID 75503126
(4-methyl-1,3-thiazol-2-yl)methyl 2-(triazol-1-yl)benzoate (PubChem CID 75503126) has the molecular formula C14H12N4O2S and a molecular weight of 300.34 g/mol. Its IUPAC name is (4-methyl-1,3-thiazol-2-yl)methyl 2-(triazol-1-yl)benzoate.
| Compound Name | (4-methyl-1,3-thiazol-2-yl)methyl 2-(triazol-1-yl)benzoate |
|---|---|
| PubChem CID | 75503126 |
| Molecular Formula | C14H12N4O2S |
| Molecular Weight | 300.34 g/mol |
| Exact Mass | 300.07 |
| IUPAC Name | (4-methyl-1,3-thiazol-2-yl)methyl 2-(triazol-1-yl)benzoate |
| SMILES | Cc1csc(COC(=O)c2ccccc2-n2ccnn2)n1 |
| InChI | InChI=1S/C14H12N4O2S/c1-10-9-21-13(16-10)8-20-14(19)11-4-2-3-5-12(11)18-7-6-15-17-18/h2-7,9H,8H2,1H3 |
| InChIKey | SQUVEQKAPQLCSI-UHFFFAOYSA-N |
| XLogP | 2.39 |
| TPSA | 69.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.34 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |