C19H17N3O4S — CID 55443767
[2-[2-[2-(4-methyl-1,3-thiazol-2-yl)acetyl]hydrazinyl]-2-oxoethyl] naphthalene-2-carboxylate (PubChem CID 55443767) has the molecular formula C19H17N3O4S and a molecular weight of 383.43 g/mol. Its IUPAC name is [2-[2-[2-(4-methyl-1,3-thiazol-2-yl)acetyl]hydrazinyl]-2-oxoethyl] naphthalene-2-carboxylate.
| Compound Name | [2-[2-[2-(4-methyl-1,3-thiazol-2-yl)acetyl]hydrazinyl]-2-oxoethyl] naphthalene-2-carboxylate |
|---|---|
| PubChem CID | 55443767 |
| Molecular Formula | C19H17N3O4S |
| Molecular Weight | 383.43 g/mol |
| Exact Mass | 383.09 |
| IUPAC Name | [2-[2-[2-(4-methyl-1,3-thiazol-2-yl)acetyl]hydrazinyl]-2-oxoethyl] naphthalene-2-carboxylate |
| SMILES | Cc1csc(CC(=O)NNC(=O)COC(=O)c2ccc3ccccc3c2)n1 |
| InChI | InChI=1S/C19H17N3O4S/c1-12-11-27-18(20-12)9-16(23)21-22-17(24)10-26-19(25)15-7-6-13-4-2-3-5-14(13)8-15/h2-8,11H,9-10H2,1H3,(H,21,23)(H,22,24) |
| InChIKey | KWHNWEQAYXFMAE-UHFFFAOYSA-N |
| XLogP | 2.15 |
| TPSA | 97.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.43 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|