C19H22N4O5S — CID 55444726
[2-[2-[2-(4-methyl-1,3-thiazol-2-yl)acetyl]hydrazinyl]-2-oxoethyl] 2-[(3,5-dimethylbenzoyl)amino]acetate (PubChem CID 55444726) has the molecular formula C19H22N4O5S and a molecular weight of 418.48 g/mol. Its IUPAC name is [2-[2-[2-(4-methyl-1,3-thiazol-2-yl)acetyl]hydrazinyl]-2-oxoethyl] 2-[(3,5-dimethylbenzoyl)amino]acetate.
| Compound Name | [2-[2-[2-(4-methyl-1,3-thiazol-2-yl)acetyl]hydrazinyl]-2-oxoethyl] 2-[(3,5-dimethylbenzoyl)amino]acetate |
|---|---|
| PubChem CID | 55444726 |
| Molecular Formula | C19H22N4O5S |
| Molecular Weight | 418.48 g/mol |
| Exact Mass | 418.13 |
| IUPAC Name | [2-[2-[2-(4-methyl-1,3-thiazol-2-yl)acetyl]hydrazinyl]-2-oxoethyl] 2-[(3,5-dimethylbenzoyl)amino]acetate |
| SMILES | Cc1cc(C)cc(C(=O)NCC(=O)OCC(=O)NNC(=O)Cc2nc(C)cs2)c1 |
| InChI | InChI=1S/C19H22N4O5S/c1-11-4-12(2)6-14(5-11)19(27)20-8-18(26)28-9-16(25)23-22-15(24)7-17-21-13(3)10-29-17/h4-6,10H,7-9H2,1-3H3,(H,20,27)(H,22,24)(H,23,25) |
| InChIKey | QWSNIEDKGDBWHH-UHFFFAOYSA-N |
| XLogP | 0.73 |
| TPSA | 126.49 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.48 |
| LogP ≤ 5 | 0.73 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|