C17H14ClN3O5S — CID 9477631
[2-[2-[2-(4-methyl-1,3-thiazol-2-yl)acetyl]hydrazinyl]-2-oxoethyl] 5-chloro-1-benzofuran-2-carboxylate (PubChem CID 9477631) has the molecular formula C17H14ClN3O5S and a molecular weight of 407.84 g/mol. Its IUPAC name is [2-[2-[2-(4-methyl-1,3-thiazol-2-yl)acetyl]hydrazinyl]-2-oxoethyl] 5-chloro-1-benzofuran-2-carboxylate.
| Compound Name | [2-[2-[2-(4-methyl-1,3-thiazol-2-yl)acetyl]hydrazinyl]-2-oxoethyl] 5-chloro-1-benzofuran-2-carboxylate |
|---|---|
| PubChem CID | 9477631 |
| Molecular Formula | C17H14ClN3O5S |
| Molecular Weight | 407.84 g/mol |
| Exact Mass | 407.03 |
| IUPAC Name | [2-[2-[2-(4-methyl-1,3-thiazol-2-yl)acetyl]hydrazinyl]-2-oxoethyl] 5-chloro-1-benzofuran-2-carboxylate |
| SMILES | Cc1csc(CC(=O)NNC(=O)COC(=O)c2cc3cc(Cl)ccc3o2)n1 |
| InChI | InChI=1S/C17H14ClN3O5S/c1-9-8-27-16(19-9)6-14(22)20-21-15(23)7-25-17(24)13-5-10-4-11(18)2-3-12(10)26-13/h2-5,8H,6-7H2,1H3,(H,20,22)(H,21,23) |
| InChIKey | ZOQHPSMILOIQFY-UHFFFAOYSA-N |
| XLogP | 2.40 |
| TPSA | 110.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.84 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|