C15H14IN3O5S — CID 55443900
[2-[2-[2-(4-methyl-1,3-thiazol-2-yl)acetyl]hydrazinyl]-2-oxoethyl] (E)-3-(5-iodofuran-2-yl)prop-2-enoate (PubChem CID 55443900) has the molecular formula C15H14IN3O5S and a molecular weight of 475.26 g/mol. Its IUPAC name is [2-[2-[2-(4-methyl-1,3-thiazol-2-yl)acetyl]hydrazinyl]-2-oxoethyl] (E)-3-(5-iodofuran-2-yl)prop-2-enoate.
| Compound Name | [2-[2-[2-(4-methyl-1,3-thiazol-2-yl)acetyl]hydrazinyl]-2-oxoethyl] (E)-3-(5-iodofuran-2-yl)prop-2-enoate |
|---|---|
| PubChem CID | 55443900 |
| Molecular Formula | C15H14IN3O5S |
| Molecular Weight | 475.26 g/mol |
| Exact Mass | 474.97 |
| IUPAC Name | [2-[2-[2-(4-methyl-1,3-thiazol-2-yl)acetyl]hydrazinyl]-2-oxoethyl] (E)-3-(5-iodofuran-2-yl)prop-2-enoate |
| SMILES | Cc1csc(CC(=O)NNC(=O)COC(=O)/C=C/c2ccc(I)o2)n1 |
| InChI | InChI=1S/C15H14IN3O5S/c1-9-8-25-14(17-9)6-12(20)18-19-13(21)7-23-15(22)5-3-10-2-4-11(16)24-10/h2-5,8H,6-7H2,1H3,(H,18,20)(H,19,21)/b5-3+ |
| InChIKey | SLJDBTUXZIBCAC-HWKANZROSA-N |
| XLogP | 1.60 |
| TPSA | 110.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.26 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|