C19H20INO6 — CID 55397100
[2-[2-(4-ethoxyphenoxy)ethylamino]-2-oxoethyl] (E)-3-(5-iodofuran-2-yl)prop-2-enoate (PubChem CID 55397100) has the molecular formula C19H20INO6 and a molecular weight of 485.27 g/mol. Its IUPAC name is [2-[2-(4-ethoxyphenoxy)ethylamino]-2-oxoethyl] (E)-3-(5-iodofuran-2-yl)prop-2-enoate.
| Compound Name | [2-[2-(4-ethoxyphenoxy)ethylamino]-2-oxoethyl] (E)-3-(5-iodofuran-2-yl)prop-2-enoate |
|---|---|
| PubChem CID | 55397100 |
| Molecular Formula | C19H20INO6 |
| Molecular Weight | 485.27 g/mol |
| Exact Mass | 485.03 |
| IUPAC Name | [2-[2-(4-ethoxyphenoxy)ethylamino]-2-oxoethyl] (E)-3-(5-iodofuran-2-yl)prop-2-enoate |
| SMILES | CCOc1ccc(OCCNC(=O)COC(=O)/C=C/c2ccc(I)o2)cc1 |
| InChI | InChI=1S/C19H20INO6/c1-2-24-14-3-5-15(6-4-14)25-12-11-21-18(22)13-26-19(23)10-8-16-7-9-17(20)27-16/h3-10H,2,11-13H2,1H3,(H,21,22)/b10-8+ |
| InChIKey | CZNKQPATUYWFHU-CSKARUKUSA-N |
| XLogP | 3.03 |
| TPSA | 87.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.27 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|