C18H18INO5 — CID 55417563
[1-(4-ethoxyanilino)-1-oxopropan-2-yl] (E)-3-(5-iodofuran-2-yl)prop-2-enoate (PubChem CID 55417563) has the molecular formula C18H18INO5 and a molecular weight of 455.25 g/mol. Its IUPAC name is [1-(4-ethoxyanilino)-1-oxopropan-2-yl] (E)-3-(5-iodofuran-2-yl)prop-2-enoate.
| Compound Name | [1-(4-ethoxyanilino)-1-oxopropan-2-yl] (E)-3-(5-iodofuran-2-yl)prop-2-enoate |
|---|---|
| PubChem CID | 55417563 |
| Molecular Formula | C18H18INO5 |
| Molecular Weight | 455.25 g/mol |
| Exact Mass | 455.02 |
| IUPAC Name | [1-(4-ethoxyanilino)-1-oxopropan-2-yl] (E)-3-(5-iodofuran-2-yl)prop-2-enoate |
| SMILES | CCOc1ccc(NC(=O)C(C)OC(=O)/C=C/c2ccc(I)o2)cc1 |
| InChI | InChI=1S/C18H18INO5/c1-3-23-14-6-4-13(5-7-14)20-18(22)12(2)24-17(21)11-9-15-8-10-16(19)25-15/h4-12H,3H2,1-2H3,(H,20,22)/b11-9+ |
| InChIKey | YNMIWNXVTUUTFF-PKNBQFBNSA-N |
| XLogP | 3.87 |
| TPSA | 77.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.25 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|