C20H21NO6 — CID 8733496
[(2R)-1-(4-ethoxyanilino)-1-oxopropan-2-yl] 2-(4-formylphenoxy)acetate (PubChem CID 8733496) has the molecular formula C20H21NO6 and a molecular weight of 371.39 g/mol. Its IUPAC name is [(2R)-1-(4-ethoxyanilino)-1-oxopropan-2-yl] 2-(4-formylphenoxy)acetate.
| Compound Name | [(2R)-1-(4-ethoxyanilino)-1-oxopropan-2-yl] 2-(4-formylphenoxy)acetate |
|---|---|
| PubChem CID | 8733496 |
| Molecular Formula | C20H21NO6 |
| Molecular Weight | 371.39 g/mol |
| Exact Mass | 371.14 |
| IUPAC Name | [(2R)-1-(4-ethoxyanilino)-1-oxopropan-2-yl] 2-(4-formylphenoxy)acetate |
| SMILES | CCOc1ccc(NC(=O)[C@@H](C)OC(=O)COc2ccc(C=O)cc2)cc1 |
| InChI | InChI=1S/C20H21NO6/c1-3-25-17-10-6-16(7-11-17)21-20(24)14(2)27-19(23)13-26-18-8-4-15(12-22)5-9-18/h4-12,14H,3,13H2,1-2H3,(H,21,24)/t14-/m1/s1 |
| InChIKey | RQJHGZMJPOXACX-CQSZACIVSA-N |
| XLogP | 2.85 |
| TPSA | 90.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.39 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|