C18H21N3O5 — CID 8849787
[(2R)-1-oxo-1-[(1,3,5-trimethylpyrazol-4-yl)amino]propan-2-yl] 2-(4-formylphenoxy)acetate (PubChem CID 8849787) has the molecular formula C18H21N3O5 and a molecular weight of 359.38 g/mol. Its IUPAC name is [(2R)-1-oxo-1-[(1,3,5-trimethylpyrazol-4-yl)amino]propan-2-yl] 2-(4-formylphenoxy)acetate.
| Compound Name | [(2R)-1-oxo-1-[(1,3,5-trimethylpyrazol-4-yl)amino]propan-2-yl] 2-(4-formylphenoxy)acetate |
|---|---|
| PubChem CID | 8849787 |
| Molecular Formula | C18H21N3O5 |
| Molecular Weight | 359.38 g/mol |
| Exact Mass | 359.15 |
| IUPAC Name | [(2R)-1-oxo-1-[(1,3,5-trimethylpyrazol-4-yl)amino]propan-2-yl] 2-(4-formylphenoxy)acetate |
| SMILES | Cc1nn(C)c(C)c1NC(=O)[C@@H](C)OC(=O)COc1ccc(C=O)cc1 |
| InChI | InChI=1S/C18H21N3O5/c1-11-17(12(2)21(4)20-11)19-18(24)13(3)26-16(23)10-25-15-7-5-14(9-22)6-8-15/h5-9,13H,10H2,1-4H3,(H,19,24)/t13-/m1/s1 |
| InChIKey | KFKSXJOTHOXKKJ-CYBMUJFWSA-N |
| XLogP | 1.80 |
| TPSA | 99.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.38 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|