C19H18FNO5 — CID 8733614
[(2S)-1-(3-fluoro-4-methylanilino)-1-oxopropan-2-yl] 2-(4-formylphenoxy)acetate (PubChem CID 8733614) has the molecular formula C19H18FNO5 and a molecular weight of 359.35 g/mol. Its IUPAC name is [(2S)-1-(3-fluoro-4-methylanilino)-1-oxopropan-2-yl] 2-(4-formylphenoxy)acetate.
| Compound Name | [(2S)-1-(3-fluoro-4-methylanilino)-1-oxopropan-2-yl] 2-(4-formylphenoxy)acetate |
|---|---|
| PubChem CID | 8733614 |
| Molecular Formula | C19H18FNO5 |
| Molecular Weight | 359.35 g/mol |
| Exact Mass | 359.12 |
| IUPAC Name | [(2S)-1-(3-fluoro-4-methylanilino)-1-oxopropan-2-yl] 2-(4-formylphenoxy)acetate |
| SMILES | Cc1ccc(NC(=O)[C@H](C)OC(=O)COc2ccc(C=O)cc2)cc1F |
| InChI | InChI=1S/C19H18FNO5/c1-12-3-6-15(9-17(12)20)21-19(24)13(2)26-18(23)11-25-16-7-4-14(10-22)5-8-16/h3-10,13H,11H2,1-2H3,(H,21,24)/t13-/m0/s1 |
| InChIKey | LMXPPJBIIWWFRX-ZDUSSCGKSA-N |
| XLogP | 2.90 |
| TPSA | 81.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.35 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|