C19H20INO6 — CID 55313416
[2-[2-(3,4-dimethoxyphenyl)ethylamino]-2-oxoethyl] (E)-3-(5-iodofuran-2-yl)prop-2-enoate (PubChem CID 55313416) has the molecular formula C19H20INO6 and a molecular weight of 485.27 g/mol. Its IUPAC name is [2-[2-(3,4-dimethoxyphenyl)ethylamino]-2-oxoethyl] (E)-3-(5-iodofuran-2-yl)prop-2-enoate.
| Compound Name | [2-[2-(3,4-dimethoxyphenyl)ethylamino]-2-oxoethyl] (E)-3-(5-iodofuran-2-yl)prop-2-enoate |
|---|---|
| PubChem CID | 55313416 |
| Molecular Formula | C19H20INO6 |
| Molecular Weight | 485.27 g/mol |
| Exact Mass | 485.03 |
| IUPAC Name | [2-[2-(3,4-dimethoxyphenyl)ethylamino]-2-oxoethyl] (E)-3-(5-iodofuran-2-yl)prop-2-enoate |
| SMILES | COc1ccc(CCNC(=O)COC(=O)/C=C/c2ccc(I)o2)cc1OC |
| InChI | InChI=1S/C19H20INO6/c1-24-15-6-3-13(11-16(15)25-2)9-10-21-18(22)12-26-19(23)8-5-14-4-7-17(20)27-14/h3-8,11H,9-10,12H2,1-2H3,(H,21,22)/b8-5+ |
| InChIKey | XMMABUHPGRPTGV-VMPITWQZSA-N |
| XLogP | 2.82 |
| TPSA | 87.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.27 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|