C17H15IN2O5 — CID 55397468
[2-[4-(methylcarbamoyl)anilino]-2-oxoethyl] (E)-3-(5-iodofuran-2-yl)prop-2-enoate (PubChem CID 55397468) has the molecular formula C17H15IN2O5 and a molecular weight of 454.22 g/mol. Its IUPAC name is [2-[4-(methylcarbamoyl)anilino]-2-oxoethyl] (E)-3-(5-iodofuran-2-yl)prop-2-enoate.
| Compound Name | [2-[4-(methylcarbamoyl)anilino]-2-oxoethyl] (E)-3-(5-iodofuran-2-yl)prop-2-enoate |
|---|---|
| PubChem CID | 55397468 |
| Molecular Formula | C17H15IN2O5 |
| Molecular Weight | 454.22 g/mol |
| Exact Mass | 454.00 |
| IUPAC Name | [2-[4-(methylcarbamoyl)anilino]-2-oxoethyl] (E)-3-(5-iodofuran-2-yl)prop-2-enoate |
| SMILES | CNC(=O)c1ccc(NC(=O)COC(=O)/C=C/c2ccc(I)o2)cc1 |
| InChI | InChI=1S/C17H15IN2O5/c1-19-17(23)11-2-4-12(5-3-11)20-15(21)10-24-16(22)9-7-13-6-8-14(18)25-13/h2-9H,10H2,1H3,(H,19,23)(H,20,21)/b9-7+ |
| InChIKey | WTWIPJFNEOGURS-VQHVLOKHSA-N |
| XLogP | 2.44 |
| TPSA | 97.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.22 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|