C11H12N2O5 — CID 3652907
[2-(carbamoylamino)-2-oxoethyl] 3-(5-methylfuran-2-yl)prop-2-enoate (PubChem CID 3652907) has the molecular formula C11H12N2O5 and a molecular weight of 252.23 g/mol. Its IUPAC name is [2-(carbamoylamino)-2-oxoethyl] 3-(5-methylfuran-2-yl)prop-2-enoate.
| Compound Name | [2-(carbamoylamino)-2-oxoethyl] 3-(5-methylfuran-2-yl)prop-2-enoate |
|---|---|
| PubChem CID | 3652907 |
| Molecular Formula | C11H12N2O5 |
| Molecular Weight | 252.23 g/mol |
| Exact Mass | 252.07 |
| IUPAC Name | [2-(carbamoylamino)-2-oxoethyl] 3-(5-methylfuran-2-yl)prop-2-enoate |
| SMILES | Cc1ccc(C=CC(=O)OCC(=O)NC(N)=O)o1 |
| InChI | InChI=1S/C11H12N2O5/c1-7-2-3-8(18-7)4-5-10(15)17-6-9(14)13-11(12)16/h2-5H,6H2,1H3,(H3,12,13,14,16) |
| InChIKey | LJIPGLATNGBACU-UHFFFAOYSA-N |
| XLogP | 0.34 |
| TPSA | 111.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.23 |
| LogP ≤ 5 | 0.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|