C17H16N4O6S — CID 55443938
[2-[2-[2-(4-methyl-1,3-thiazol-2-yl)acetyl]hydrazinyl]-2-oxoethyl] (E)-3-(3-nitrophenyl)prop-2-enoate (PubChem CID 55443938) has the molecular formula C17H16N4O6S and a molecular weight of 404.40 g/mol. Its IUPAC name is [2-[2-[2-(4-methyl-1,3-thiazol-2-yl)acetyl]hydrazinyl]-2-oxoethyl] (E)-3-(3-nitrophenyl)prop-2-enoate.
| Compound Name | [2-[2-[2-(4-methyl-1,3-thiazol-2-yl)acetyl]hydrazinyl]-2-oxoethyl] (E)-3-(3-nitrophenyl)prop-2-enoate |
|---|---|
| PubChem CID | 55443938 |
| Molecular Formula | C17H16N4O6S |
| Molecular Weight | 404.40 g/mol |
| Exact Mass | 404.08 |
| IUPAC Name | [2-[2-[2-(4-methyl-1,3-thiazol-2-yl)acetyl]hydrazinyl]-2-oxoethyl] (E)-3-(3-nitrophenyl)prop-2-enoate |
| SMILES | Cc1csc(CC(=O)NNC(=O)COC(=O)/C=C/c2cccc([N+](=O)[O-])c2)n1 |
| InChI | InChI=1S/C17H16N4O6S/c1-11-10-28-16(18-11)8-14(22)19-20-15(23)9-27-17(24)6-5-12-3-2-4-13(7-12)21(25)26/h2-7,10H,8-9H2,1H3,(H,19,22)(H,20,23)/b6-5+ |
| InChIKey | SUXVFEDEOGCNNC-AATRIKPKSA-N |
| XLogP | 1.31 |
| TPSA | 140.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.40 |
| LogP ≤ 5 | 1.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|