C17H12F2N2O5 — CID 7812321
[2-(2,6-difluoroanilino)-2-oxoethyl] (E)-3-(3-nitrophenyl)prop-2-enoate (PubChem CID 7812321) has the molecular formula C17H12F2N2O5 and a molecular weight of 362.29 g/mol. Its IUPAC name is [2-(2,6-difluoroanilino)-2-oxoethyl] (E)-3-(3-nitrophenyl)prop-2-enoate.
| Compound Name | [2-(2,6-difluoroanilino)-2-oxoethyl] (E)-3-(3-nitrophenyl)prop-2-enoate |
|---|---|
| PubChem CID | 7812321 |
| Molecular Formula | C17H12F2N2O5 |
| Molecular Weight | 362.29 g/mol |
| Exact Mass | 362.07 |
| IUPAC Name | [2-(2,6-difluoroanilino)-2-oxoethyl] (E)-3-(3-nitrophenyl)prop-2-enoate |
| SMILES | O=C(COC(=O)/C=C/c1cccc([N+](=O)[O-])c1)Nc1c(F)cccc1F |
| InChI | InChI=1S/C17H12F2N2O5/c18-13-5-2-6-14(19)17(13)20-15(22)10-26-16(23)8-7-11-3-1-4-12(9-11)21(24)25/h1-9H,10H2,(H,20,22)/b8-7+ |
| InChIKey | FIGFNOQXGXCJCN-BQYQJAHWSA-N |
| XLogP | 3.07 |
| TPSA | 98.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.29 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|