C18H13F3N2O5 — CID 3469398
[2-oxo-2-[2-(trifluoromethyl)anilino]ethyl] 3-(3-nitrophenyl)prop-2-enoate (PubChem CID 3469398) has the molecular formula C18H13F3N2O5 and a molecular weight of 394.31 g/mol. Its IUPAC name is [2-oxo-2-[2-(trifluoromethyl)anilino]ethyl] 3-(3-nitrophenyl)prop-2-enoate.
| Compound Name | [2-oxo-2-[2-(trifluoromethyl)anilino]ethyl] 3-(3-nitrophenyl)prop-2-enoate |
|---|---|
| PubChem CID | 3469398 |
| Molecular Formula | C18H13F3N2O5 |
| Molecular Weight | 394.31 g/mol |
| Exact Mass | 394.08 |
| IUPAC Name | [2-oxo-2-[2-(trifluoromethyl)anilino]ethyl] 3-(3-nitrophenyl)prop-2-enoate |
| SMILES | O=C(COC(=O)C=Cc1cccc([N+](=O)[O-])c1)Nc1ccccc1C(F)(F)F |
| InChI | InChI=1S/C18H13F3N2O5/c19-18(20,21)14-6-1-2-7-15(14)22-16(24)11-28-17(25)9-8-12-4-3-5-13(10-12)23(26)27/h1-10H,11H2,(H,22,24) |
| InChIKey | UVBLKOPBFLYXDK-UHFFFAOYSA-N |
| XLogP | 3.81 |
| TPSA | 98.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.31 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|