C17H11F3N2O5 — CID 2567953
[2-oxo-2-(2,3,4-trifluoroanilino)ethyl] (E)-3-(3-nitrophenyl)prop-2-enoate (PubChem CID 2567953) has the molecular formula C17H11F3N2O5 and a molecular weight of 380.28 g/mol. Its IUPAC name is [2-oxo-2-(2,3,4-trifluoroanilino)ethyl] (E)-3-(3-nitrophenyl)prop-2-enoate.
| Compound Name | [2-oxo-2-(2,3,4-trifluoroanilino)ethyl] (E)-3-(3-nitrophenyl)prop-2-enoate |
|---|---|
| PubChem CID | 2567953 |
| Molecular Formula | C17H11F3N2O5 |
| Molecular Weight | 380.28 g/mol |
| Exact Mass | 380.06 |
| IUPAC Name | [2-oxo-2-(2,3,4-trifluoroanilino)ethyl] (E)-3-(3-nitrophenyl)prop-2-enoate |
| SMILES | O=C(COC(=O)/C=C/c1cccc([N+](=O)[O-])c1)Nc1ccc(F)c(F)c1F |
| InChI | InChI=1S/C17H11F3N2O5/c18-12-5-6-13(17(20)16(12)19)21-14(23)9-27-15(24)7-4-10-2-1-3-11(8-10)22(25)26/h1-8H,9H2,(H,21,23)/b7-4+ |
| InChIKey | DWSZFGXOLKPYPN-QPJJXVBHSA-N |
| XLogP | 3.21 |
| TPSA | 98.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.28 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|