About [2-(2-fluoro-5-nitroanilino)-2-oxoethyl] (E)-but-2-enoate
[2-(2-fluoro-5-nitroanilino)-2-oxoethyl] (E)-but-2-enoate (PubChem CID 2508455) has the molecular formula C12H11FN2O5
and a molecular weight of 282.23 g/mol. Its IUPAC name is [2-(2-fluoro-5-nitroanilino)-2-oxoethyl] (E)-but-2-enoate.
Molecular Properties
| Compound Name | [2-(2-fluoro-5-nitroanilino)-2-oxoethyl] (E)-but-2-enoate |
| PubChem CID | 2508455 |
| Molecular Formula | C12H11FN2O5 |
| Molecular Weight | 282.23 g/mol |
| Exact Mass | 282.07 |
| IUPAC Name | [2-(2-fluoro-5-nitroanilino)-2-oxoethyl] (E)-but-2-enoate |
| SMILES | C/C=C/C(=O)OCC(=O)Nc1cc([N+](=O)[O-])ccc1F |
| InChI | InChI=1S/C12H11FN2O5/c1-2-3-12(17)20-7-11(16)14-10-6-8(15(18)19)4-5-9(10)13/h2-6H,7H2,1H3,(H,14,16)/b3-2+ |
| InChIKey | RJNLSKCGSXCIEY-NSCUHMNNSA-N |
| XLogP | 1.79 |
| TPSA | 98.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 282.23 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze [2-(2-fluoro-5-nitroanilino)-2-oxoethyl] (E)-but-2-enoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [2-(2-fluoro-5-nitroanilino)-2-oxoethyl] (E)-but-2-enoate?
The IUPAC name of [2-(2-fluoro-5-nitroanilino)-2-oxoethyl] (E)-but-2-enoate (CID 2508455) is [2-(2-fluoro-5-nitroanilino)-2-oxoethyl] (E)-but-2-enoate.
What is the SMILES notation for [2-(2-fluoro-5-nitroanilino)-2-oxoethyl] (E)-but-2-enoate?
The canonical SMILES for [2-(2-fluoro-5-nitroanilino)-2-oxoethyl] (E)-but-2-enoate is C/C=C/C(=O)OCC(=O)Nc1cc([N+](=O)[O-])ccc1F.
What is the InChIKey of [2-(2-fluoro-5-nitroanilino)-2-oxoethyl] (E)-but-2-enoate?
The InChIKey is RJNLSKCGSXCIEY-NSCUHMNNSA-N. The full InChI is InChI=1S/C12H11FN2O5/c1-2-3-12(17)20-7-11(16)14-10-6-8(15(18)19)4-5-9(10)13/h2-6H,7H2,1H3,(H,14,16)/b3-2+.
What are the key properties of [2-(2-fluoro-5-nitroanilino)-2-oxoethyl] (E)-but-2-enoate?
[2-(2-fluoro-5-nitroanilino)-2-oxoethyl] (E)-but-2-enoate has a molecular weight of 282.23 g/mol, XLogP of 1.79, 5 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for [2-(2-fluoro-5-nitroanilino)-2-oxoethyl] (E)-but-2-enoate is sourced from PubChem (CID 2508455), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).