C12H11ClN2O5 — CID 7981215
[2-(4-chloro-2-nitroanilino)-2-oxoethyl] (E)-but-2-enoate (PubChem CID 7981215) has the molecular formula C12H11ClN2O5 and a molecular weight of 298.68 g/mol. Its IUPAC name is [2-(4-chloro-2-nitroanilino)-2-oxoethyl] (E)-but-2-enoate.
| Compound Name | [2-(4-chloro-2-nitroanilino)-2-oxoethyl] (E)-but-2-enoate |
|---|---|
| PubChem CID | 7981215 |
| Molecular Formula | C12H11ClN2O5 |
| Molecular Weight | 298.68 g/mol |
| Exact Mass | 298.04 |
| IUPAC Name | [2-(4-chloro-2-nitroanilino)-2-oxoethyl] (E)-but-2-enoate |
| SMILES | C/C=C/C(=O)OCC(=O)Nc1ccc(Cl)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C12H11ClN2O5/c1-2-3-12(17)20-7-11(16)14-9-5-4-8(13)6-10(9)15(18)19/h2-6H,7H2,1H3,(H,14,16)/b3-2+ |
| InChIKey | YNPZFZYHWJTGAE-NSCUHMNNSA-N |
| XLogP | 2.31 |
| TPSA | 98.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.68 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|