C18H15ClN2O5 — CID 7850318
[2-(4-chloro-2-nitroanilino)-2-oxoethyl] (E)-3-(2-methylphenyl)prop-2-enoate (PubChem CID 7850318) has the molecular formula C18H15ClN2O5 and a molecular weight of 374.78 g/mol. Its IUPAC name is [2-(4-chloro-2-nitroanilino)-2-oxoethyl] (E)-3-(2-methylphenyl)prop-2-enoate.
| Compound Name | [2-(4-chloro-2-nitroanilino)-2-oxoethyl] (E)-3-(2-methylphenyl)prop-2-enoate |
|---|---|
| PubChem CID | 7850318 |
| Molecular Formula | C18H15ClN2O5 |
| Molecular Weight | 374.78 g/mol |
| Exact Mass | 374.07 |
| IUPAC Name | [2-(4-chloro-2-nitroanilino)-2-oxoethyl] (E)-3-(2-methylphenyl)prop-2-enoate |
| SMILES | Cc1ccccc1/C=C/C(=O)OCC(=O)Nc1ccc(Cl)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C18H15ClN2O5/c1-12-4-2-3-5-13(12)6-9-18(23)26-11-17(22)20-15-8-7-14(19)10-16(15)21(24)25/h2-10H,11H2,1H3,(H,20,22)/b9-6+ |
| InChIKey | PLZRXTUSQXTNSY-RMKNXTFCSA-N |
| XLogP | 3.75 |
| TPSA | 98.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.78 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|