C16H12ClN3O7 — CID 33348099
[2-(4-chloro-2-nitroanilino)-2-oxoethyl] 2-methyl-6-nitrobenzoate (PubChem CID 33348099) has the molecular formula C16H12ClN3O7 and a molecular weight of 393.74 g/mol. Its IUPAC name is [2-(4-chloro-2-nitroanilino)-2-oxoethyl] 2-methyl-6-nitrobenzoate.
| Compound Name | [2-(4-chloro-2-nitroanilino)-2-oxoethyl] 2-methyl-6-nitrobenzoate |
|---|---|
| PubChem CID | 33348099 |
| Molecular Formula | C16H12ClN3O7 |
| Molecular Weight | 393.74 g/mol |
| Exact Mass | 393.04 |
| IUPAC Name | [2-(4-chloro-2-nitroanilino)-2-oxoethyl] 2-methyl-6-nitrobenzoate |
| SMILES | Cc1cccc([N+](=O)[O-])c1C(=O)OCC(=O)Nc1ccc(Cl)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C16H12ClN3O7/c1-9-3-2-4-12(19(23)24)15(9)16(22)27-8-14(21)18-11-6-5-10(17)7-13(11)20(25)26/h2-7H,8H2,1H3,(H,18,21) |
| InChIKey | TYRIIWNCFLTACN-UHFFFAOYSA-N |
| XLogP | 3.26 |
| TPSA | 141.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.74 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|