C13H10ClN3O6 — CID 7737610
[2-(4-chloro-2-nitroanilino)-2-oxoethyl] 3-methyl-1,2-oxazole-5-carboxylate (PubChem CID 7737610) has the molecular formula C13H10ClN3O6 and a molecular weight of 339.69 g/mol. Its IUPAC name is [2-(4-chloro-2-nitroanilino)-2-oxoethyl] 3-methyl-1,2-oxazole-5-carboxylate.
| Compound Name | [2-(4-chloro-2-nitroanilino)-2-oxoethyl] 3-methyl-1,2-oxazole-5-carboxylate |
|---|---|
| PubChem CID | 7737610 |
| Molecular Formula | C13H10ClN3O6 |
| Molecular Weight | 339.69 g/mol |
| Exact Mass | 339.03 |
| IUPAC Name | [2-(4-chloro-2-nitroanilino)-2-oxoethyl] 3-methyl-1,2-oxazole-5-carboxylate |
| SMILES | Cc1cc(C(=O)OCC(=O)Nc2ccc(Cl)cc2[N+](=O)[O-])on1 |
| InChI | InChI=1S/C13H10ClN3O6/c1-7-4-11(23-16-7)13(19)22-6-12(18)15-9-3-2-8(14)5-10(9)17(20)21/h2-5H,6H2,1H3,(H,15,18) |
| InChIKey | UBAYPVYWOQFYGR-UHFFFAOYSA-N |
| XLogP | 2.34 |
| TPSA | 124.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.69 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|