C18H13ClF3NO3 — CID 4854506
[2-[4-chloro-2-(trifluoromethyl)anilino]-2-oxoethyl] 3-phenylprop-2-enoate (PubChem CID 4854506) has the molecular formula C18H13ClF3NO3 and a molecular weight of 383.75 g/mol. Its IUPAC name is [2-[4-chloro-2-(trifluoromethyl)anilino]-2-oxoethyl] 3-phenylprop-2-enoate.
| Compound Name | [2-[4-chloro-2-(trifluoromethyl)anilino]-2-oxoethyl] 3-phenylprop-2-enoate |
|---|---|
| PubChem CID | 4854506 |
| Molecular Formula | C18H13ClF3NO3 |
| Molecular Weight | 383.75 g/mol |
| Exact Mass | 383.05 |
| IUPAC Name | [2-[4-chloro-2-(trifluoromethyl)anilino]-2-oxoethyl] 3-phenylprop-2-enoate |
| SMILES | O=C(COC(=O)C=Cc1ccccc1)Nc1ccc(Cl)cc1C(F)(F)F |
| InChI | InChI=1S/C18H13ClF3NO3/c19-13-7-8-15(14(10-13)18(20,21)22)23-16(24)11-26-17(25)9-6-12-4-2-1-3-5-12/h1-10H,11H2,(H,23,24) |
| InChIKey | BNFGCXVRPCBOGX-UHFFFAOYSA-N |
| XLogP | 4.55 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.75 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|