C24H22ClF3N2O4 — CID 31728468
[2-[4-chloro-2-(trifluoromethyl)anilino]-2-oxoethyl] 1-[(E)-3-phenylprop-2-enoyl]piperidine-4-carboxylate (PubChem CID 31728468) has the molecular formula C24H22ClF3N2O4 and a molecular weight of 494.90 g/mol. Its IUPAC name is [2-[4-chloro-2-(trifluoromethyl)anilino]-2-oxoethyl] 1-[(E)-3-phenylprop-2-enoyl]piperidine-4-carboxylate.
| Compound Name | [2-[4-chloro-2-(trifluoromethyl)anilino]-2-oxoethyl] 1-[(E)-3-phenylprop-2-enoyl]piperidine-4-carboxylate |
|---|---|
| PubChem CID | 31728468 |
| Molecular Formula | C24H22ClF3N2O4 |
| Molecular Weight | 494.90 g/mol |
| Exact Mass | 494.12 |
| IUPAC Name | [2-[4-chloro-2-(trifluoromethyl)anilino]-2-oxoethyl] 1-[(E)-3-phenylprop-2-enoyl]piperidine-4-carboxylate |
| SMILES | O=C(COC(=O)C1CCN(C(=O)/C=C/c2ccccc2)CC1)Nc1ccc(Cl)cc1C(F)(F)F |
| InChI | InChI=1S/C24H22ClF3N2O4/c25-18-7-8-20(19(14-18)24(26,27)28)29-21(31)15-34-23(33)17-10-12-30(13-11-17)22(32)9-6-16-4-2-1-3-5-16/h1-9,14,17H,10-13,15H2,(H,29,31)/b9-6+ |
| InChIKey | GGNZVYBZKFBYFT-RMKNXTFCSA-N |
| XLogP | 4.79 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.90 |
| LogP ≤ 5 | 4.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|