C20H16ClF3N2O4 — CID 4853133
[2-[4-chloro-2-(trifluoromethyl)anilino]-2-oxoethyl] 2-acetamido-3-phenylprop-2-enoate (PubChem CID 4853133) has the molecular formula C20H16ClF3N2O4 and a molecular weight of 440.81 g/mol. Its IUPAC name is [2-[4-chloro-2-(trifluoromethyl)anilino]-2-oxoethyl] 2-acetamido-3-phenylprop-2-enoate.
| Compound Name | [2-[4-chloro-2-(trifluoromethyl)anilino]-2-oxoethyl] 2-acetamido-3-phenylprop-2-enoate |
|---|---|
| PubChem CID | 4853133 |
| Molecular Formula | C20H16ClF3N2O4 |
| Molecular Weight | 440.81 g/mol |
| Exact Mass | 440.08 |
| IUPAC Name | [2-[4-chloro-2-(trifluoromethyl)anilino]-2-oxoethyl] 2-acetamido-3-phenylprop-2-enoate |
| SMILES | CC(=O)NC(=Cc1ccccc1)C(=O)OCC(=O)Nc1ccc(Cl)cc1C(F)(F)F |
| InChI | InChI=1S/C20H16ClF3N2O4/c1-12(27)25-17(9-13-5-3-2-4-6-13)19(29)30-11-18(28)26-16-8-7-14(21)10-15(16)20(22,23)24/h2-10H,11H2,1H3,(H,25,27)(H,26,28) |
| InChIKey | NJNPENPYRDWMHC-UHFFFAOYSA-N |
| XLogP | 4.02 |
| TPSA | 84.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.81 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|