C20H20N2O5 — CID 7284834
[2-(4-methoxyanilino)-2-oxoethyl] (Z)-2-acetamido-3-phenylprop-2-enoate (PubChem CID 7284834) has the molecular formula C20H20N2O5 and a molecular weight of 368.39 g/mol. Its IUPAC name is [2-(4-methoxyanilino)-2-oxoethyl] (Z)-2-acetamido-3-phenylprop-2-enoate.
| Compound Name | [2-(4-methoxyanilino)-2-oxoethyl] (Z)-2-acetamido-3-phenylprop-2-enoate |
|---|---|
| PubChem CID | 7284834 |
| Molecular Formula | C20H20N2O5 |
| Molecular Weight | 368.39 g/mol |
| Exact Mass | 368.14 |
| IUPAC Name | [2-(4-methoxyanilino)-2-oxoethyl] (Z)-2-acetamido-3-phenylprop-2-enoate |
| SMILES | COc1ccc(NC(=O)COC(=O)/C(=C/c2ccccc2)NC(C)=O)cc1 |
| InChI | InChI=1S/C20H20N2O5/c1-14(23)21-18(12-15-6-4-3-5-7-15)20(25)27-13-19(24)22-16-8-10-17(26-2)11-9-16/h3-12H,13H2,1-2H3,(H,21,23)(H,22,24)/b18-12- |
| InChIKey | CDEYUEGOBVEOLE-PDGQHHTCSA-N |
| XLogP | 2.35 |
| TPSA | 93.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.39 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|