C24H26N2O5 — CID 55524598
[2-[[cyclopropyl-(4-methoxyphenyl)methyl]amino]-2-oxoethyl] (Z)-2-acetamido-3-phenylprop-2-enoate (PubChem CID 55524598) has the molecular formula C24H26N2O5 and a molecular weight of 422.48 g/mol. Its IUPAC name is [2-[[cyclopropyl-(4-methoxyphenyl)methyl]amino]-2-oxoethyl] (Z)-2-acetamido-3-phenylprop-2-enoate.
| Compound Name | [2-[[cyclopropyl-(4-methoxyphenyl)methyl]amino]-2-oxoethyl] (Z)-2-acetamido-3-phenylprop-2-enoate |
|---|---|
| PubChem CID | 55524598 |
| Molecular Formula | C24H26N2O5 |
| Molecular Weight | 422.48 g/mol |
| Exact Mass | 422.18 |
| IUPAC Name | [2-[[cyclopropyl-(4-methoxyphenyl)methyl]amino]-2-oxoethyl] (Z)-2-acetamido-3-phenylprop-2-enoate |
| SMILES | COc1ccc(C(NC(=O)COC(=O)/C(=C/c2ccccc2)NC(C)=O)C2CC2)cc1 |
| InChI | InChI=1S/C24H26N2O5/c1-16(27)25-21(14-17-6-4-3-5-7-17)24(29)31-15-22(28)26-23(18-8-9-18)19-10-12-20(30-2)13-11-19/h3-7,10-14,18,23H,8-9,15H2,1-2H3,(H,25,27)(H,26,28)/b21-14- |
| InChIKey | NSLFXCMARGPZKN-STZFKDTASA-N |
| XLogP | 2.98 |
| TPSA | 93.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.48 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|