C20H20N2O4 — CID 7284841
[2-(benzylamino)-2-oxoethyl] (Z)-2-acetamido-3-phenylprop-2-enoate (PubChem CID 7284841) has the molecular formula C20H20N2O4 and a molecular weight of 352.39 g/mol. Its IUPAC name is [2-(benzylamino)-2-oxoethyl] (Z)-2-acetamido-3-phenylprop-2-enoate.
| Compound Name | [2-(benzylamino)-2-oxoethyl] (Z)-2-acetamido-3-phenylprop-2-enoate |
|---|---|
| PubChem CID | 7284841 |
| Molecular Formula | C20H20N2O4 |
| Molecular Weight | 352.39 g/mol |
| Exact Mass | 352.14 |
| IUPAC Name | [2-(benzylamino)-2-oxoethyl] (Z)-2-acetamido-3-phenylprop-2-enoate |
| SMILES | CC(=O)N/C(=C\c1ccccc1)C(=O)OCC(=O)NCc1ccccc1 |
| InChI | InChI=1S/C20H20N2O4/c1-15(23)22-18(12-16-8-4-2-5-9-16)20(25)26-14-19(24)21-13-17-10-6-3-7-11-17/h2-12H,13-14H2,1H3,(H,21,24)(H,22,23)/b18-12- |
| InChIKey | WZUPLXCQCZKSOL-PDGQHHTCSA-N |
| XLogP | 2.02 |
| TPSA | 84.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.39 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|