C20H18Cl3NO4 — CID 55524114
[2-[[cyclopropyl-(4-methoxyphenyl)methyl]amino]-2-oxoethyl] 2,3,6-trichlorobenzoate (PubChem CID 55524114) has the molecular formula C20H18Cl3NO4 and a molecular weight of 442.73 g/mol. Its IUPAC name is [2-[[cyclopropyl-(4-methoxyphenyl)methyl]amino]-2-oxoethyl] 2,3,6-trichlorobenzoate.
| Compound Name | [2-[[cyclopropyl-(4-methoxyphenyl)methyl]amino]-2-oxoethyl] 2,3,6-trichlorobenzoate |
|---|---|
| PubChem CID | 55524114 |
| Molecular Formula | C20H18Cl3NO4 |
| Molecular Weight | 442.73 g/mol |
| Exact Mass | 441.03 |
| IUPAC Name | [2-[[cyclopropyl-(4-methoxyphenyl)methyl]amino]-2-oxoethyl] 2,3,6-trichlorobenzoate |
| SMILES | COc1ccc(C(NC(=O)COC(=O)c2c(Cl)ccc(Cl)c2Cl)C2CC2)cc1 |
| InChI | InChI=1S/C20H18Cl3NO4/c1-27-13-6-4-12(5-7-13)19(11-2-3-11)24-16(25)10-28-20(26)17-14(21)8-9-15(22)18(17)23/h4-9,11,19H,2-3,10H2,1H3,(H,24,25) |
| InChIKey | GAPXLZAWKNOIQV-UHFFFAOYSA-N |
| XLogP | 5.08 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.73 |
| LogP ≤ 5 | 5.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|