C24H26N2O6 — CID 18225441
butyl 4-[[2-[(Z)-2-acetamido-3-phenylprop-2-enoyl]oxyacetyl]amino]benzoate (PubChem CID 18225441) has the molecular formula C24H26N2O6 and a molecular weight of 438.48 g/mol. Its IUPAC name is butyl 4-[[2-[(Z)-2-acetamido-3-phenylprop-2-enoyl]oxyacetyl]amino]benzoate.
| Compound Name | butyl 4-[[2-[(Z)-2-acetamido-3-phenylprop-2-enoyl]oxyacetyl]amino]benzoate |
|---|---|
| PubChem CID | 18225441 |
| Molecular Formula | C24H26N2O6 |
| Molecular Weight | 438.48 g/mol |
| Exact Mass | 438.18 |
| IUPAC Name | butyl 4-[[2-[(Z)-2-acetamido-3-phenylprop-2-enoyl]oxyacetyl]amino]benzoate |
| SMILES | CCCCOC(=O)c1ccc(NC(=O)COC(=O)/C(=C/c2ccccc2)NC(C)=O)cc1 |
| InChI | InChI=1S/C24H26N2O6/c1-3-4-14-31-23(29)19-10-12-20(13-11-19)26-22(28)16-32-24(30)21(25-17(2)27)15-18-8-6-5-7-9-18/h5-13,15H,3-4,14,16H2,1-2H3,(H,25,27)(H,26,28)/b21-15- |
| InChIKey | DQQMKAWRKZAQSU-QNGOZBTKSA-N |
| XLogP | 3.30 |
| TPSA | 110.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.48 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|