C25H23NO3 — CID 6380758
propyl 4-[[(E)-2,3-diphenylprop-2-enoyl]amino]benzoate (PubChem CID 6380758) has the molecular formula C25H23NO3 and a molecular weight of 385.46 g/mol. Its IUPAC name is propyl 4-[[(E)-2,3-diphenylprop-2-enoyl]amino]benzoate.
| Compound Name | propyl 4-[[(E)-2,3-diphenylprop-2-enoyl]amino]benzoate |
|---|---|
| PubChem CID | 6380758 |
| Molecular Formula | C25H23NO3 |
| Molecular Weight | 385.46 g/mol |
| Exact Mass | 385.17 |
| IUPAC Name | propyl 4-[[(E)-2,3-diphenylprop-2-enoyl]amino]benzoate |
| SMILES | CCCOC(=O)c1ccc(NC(=O)/C(=C/c2ccccc2)c2ccccc2)cc1 |
| InChI | InChI=1S/C25H23NO3/c1-2-17-29-25(28)21-13-15-22(16-14-21)26-24(27)23(20-11-7-4-8-12-20)18-19-9-5-3-6-10-19/h3-16,18H,2,17H2,1H3,(H,26,27)/b23-18+ |
| InChIKey | REWGLOGCUXVNRY-PTGBLXJZSA-N |
| XLogP | 5.43 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.46 |
| LogP ≤ 5 | 5.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|