C18H15Cl2N3O4 — CID 7554976
[2-[(3,5-dichloro-2-pyridinyl)amino]-2-oxoethyl] (Z)-2-acetamido-3-phenylprop-2-enoate (PubChem CID 7554976) has the molecular formula C18H15Cl2N3O4 and a molecular weight of 408.24 g/mol. Its IUPAC name is [2-[(3,5-dichloro-2-pyridinyl)amino]-2-oxoethyl] (Z)-2-acetamido-3-phenylprop-2-enoate.
| Compound Name | [2-[(3,5-dichloro-2-pyridinyl)amino]-2-oxoethyl] (Z)-2-acetamido-3-phenylprop-2-enoate |
|---|---|
| PubChem CID | 7554976 |
| Molecular Formula | C18H15Cl2N3O4 |
| Molecular Weight | 408.24 g/mol |
| Exact Mass | 407.04 |
| IUPAC Name | [2-[(3,5-dichloro-2-pyridinyl)amino]-2-oxoethyl] (Z)-2-acetamido-3-phenylprop-2-enoate |
| SMILES | CC(=O)N/C(=C\c1ccccc1)C(=O)OCC(=O)Nc1ncc(Cl)cc1Cl |
| InChI | InChI=1S/C18H15Cl2N3O4/c1-11(24)22-15(7-12-5-3-2-4-6-12)18(26)27-10-16(25)23-17-14(20)8-13(19)9-21-17/h2-9H,10H2,1H3,(H,22,24)(H,21,23,25)/b15-7- |
| InChIKey | JDWSOEPGCHBLIQ-CHHVJCJISA-N |
| XLogP | 3.05 |
| TPSA | 97.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.24 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|