C19H22N4O4 — CID 98572561
[2-oxo-2-[(2-propan-2-ylpyrazol-3-yl)amino]ethyl] (E)-2-acetamido-3-phenylprop-2-enoate (PubChem CID 98572561) has the molecular formula C19H22N4O4 and a molecular weight of 370.41 g/mol. Its IUPAC name is [2-oxo-2-[(2-propan-2-ylpyrazol-3-yl)amino]ethyl] (E)-2-acetamido-3-phenylprop-2-enoate.
| Compound Name | [2-oxo-2-[(2-propan-2-ylpyrazol-3-yl)amino]ethyl] (E)-2-acetamido-3-phenylprop-2-enoate |
|---|---|
| PubChem CID | 98572561 |
| Molecular Formula | C19H22N4O4 |
| Molecular Weight | 370.41 g/mol |
| Exact Mass | 370.16 |
| IUPAC Name | [2-oxo-2-[(2-propan-2-ylpyrazol-3-yl)amino]ethyl] (E)-2-acetamido-3-phenylprop-2-enoate |
| SMILES | CC(=O)N/C(=C/c1ccccc1)C(=O)OCC(=O)Nc1ccnn1C(C)C |
| InChI | InChI=1S/C19H22N4O4/c1-13(2)23-17(9-10-20-23)22-18(25)12-27-19(26)16(21-14(3)24)11-15-7-5-4-6-8-15/h4-11,13H,12H2,1-3H3,(H,21,24)(H,22,25)/b16-11+ |
| InChIKey | JHGZSRVYLZMRPB-LFIBNONCSA-N |
| XLogP | 2.12 |
| TPSA | 102.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.41 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|