C20H19ClN2O4 — CID 7991335
[2-(4-chloro-2-methylanilino)-2-oxoethyl] 2-[[(E)-3-phenylprop-2-enoyl]amino]acetate (PubChem CID 7991335) has the molecular formula C20H19ClN2O4 and a molecular weight of 386.84 g/mol. Its IUPAC name is [2-(4-chloro-2-methylanilino)-2-oxoethyl] 2-[[(E)-3-phenylprop-2-enoyl]amino]acetate.
| Compound Name | [2-(4-chloro-2-methylanilino)-2-oxoethyl] 2-[[(E)-3-phenylprop-2-enoyl]amino]acetate |
|---|---|
| PubChem CID | 7991335 |
| Molecular Formula | C20H19ClN2O4 |
| Molecular Weight | 386.84 g/mol |
| Exact Mass | 386.10 |
| IUPAC Name | [2-(4-chloro-2-methylanilino)-2-oxoethyl] 2-[[(E)-3-phenylprop-2-enoyl]amino]acetate |
| SMILES | Cc1cc(Cl)ccc1NC(=O)COC(=O)CNC(=O)/C=C/c1ccccc1 |
| InChI | InChI=1S/C20H19ClN2O4/c1-14-11-16(21)8-9-17(14)23-19(25)13-27-20(26)12-22-18(24)10-7-15-5-3-2-4-6-15/h2-11H,12-13H2,1H3,(H,22,24)(H,23,25)/b10-7+ |
| InChIKey | IDLNQRALZREOGY-JXMROGBWSA-N |
| XLogP | 2.96 |
| TPSA | 84.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.84 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|