C19H16F2N2O4 — CID 7991718
[2-(2,6-difluoroanilino)-2-oxoethyl] 2-[[(E)-3-phenylprop-2-enoyl]amino]acetate (PubChem CID 7991718) has the molecular formula C19H16F2N2O4 and a molecular weight of 374.34 g/mol. Its IUPAC name is [2-(2,6-difluoroanilino)-2-oxoethyl] 2-[[(E)-3-phenylprop-2-enoyl]amino]acetate.
| Compound Name | [2-(2,6-difluoroanilino)-2-oxoethyl] 2-[[(E)-3-phenylprop-2-enoyl]amino]acetate |
|---|---|
| PubChem CID | 7991718 |
| Molecular Formula | C19H16F2N2O4 |
| Molecular Weight | 374.34 g/mol |
| Exact Mass | 374.11 |
| IUPAC Name | [2-(2,6-difluoroanilino)-2-oxoethyl] 2-[[(E)-3-phenylprop-2-enoyl]amino]acetate |
| SMILES | O=C(/C=C/c1ccccc1)NCC(=O)OCC(=O)Nc1c(F)cccc1F |
| InChI | InChI=1S/C19H16F2N2O4/c20-14-7-4-8-15(21)19(14)23-17(25)12-27-18(26)11-22-16(24)10-9-13-5-2-1-3-6-13/h1-10H,11-12H2,(H,22,24)(H,23,25)/b10-9+ |
| InChIKey | DODRBIZJYQGYBE-MDZDMXLPSA-N |
| XLogP | 2.28 |
| TPSA | 84.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.34 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|