C22H22N2O4 — CID 7991402
[2-(2,3-dihydro-1H-inden-5-ylamino)-2-oxoethyl] 2-[[(E)-3-phenylprop-2-enoyl]amino]acetate (PubChem CID 7991402) has the molecular formula C22H22N2O4 and a molecular weight of 378.43 g/mol. Its IUPAC name is [2-(2,3-dihydro-1H-inden-5-ylamino)-2-oxoethyl] 2-[[(E)-3-phenylprop-2-enoyl]amino]acetate.
| Compound Name | [2-(2,3-dihydro-1H-inden-5-ylamino)-2-oxoethyl] 2-[[(E)-3-phenylprop-2-enoyl]amino]acetate |
|---|---|
| PubChem CID | 7991402 |
| Molecular Formula | C22H22N2O4 |
| Molecular Weight | 378.43 g/mol |
| Exact Mass | 378.16 |
| IUPAC Name | [2-(2,3-dihydro-1H-inden-5-ylamino)-2-oxoethyl] 2-[[(E)-3-phenylprop-2-enoyl]amino]acetate |
| SMILES | O=C(/C=C/c1ccccc1)NCC(=O)OCC(=O)Nc1ccc2c(c1)CCC2 |
| InChI | InChI=1S/C22H22N2O4/c25-20(12-9-16-5-2-1-3-6-16)23-14-22(27)28-15-21(26)24-19-11-10-17-7-4-8-18(17)13-19/h1-3,5-6,9-13H,4,7-8,14-15H2,(H,23,25)(H,24,26)/b12-9+ |
| InChIKey | WYJDLKISIKRRBR-FMIVXFBMSA-N |
| XLogP | 2.49 |
| TPSA | 84.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.43 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|